C15H19FN2O2 — CID 82950139
N-[1-(dimethylamino)propan-2-yl]-5-fluoro-2-(3-hydroxyprop-1-ynyl)benzamide (PubChem CID 82950139) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is N-[1-(dimethylamino)propan-2-yl]-5-fluoro-2-(3-hydroxyprop-1-ynyl)benzamide.
| Compound Name | N-[1-(dimethylamino)propan-2-yl]-5-fluoro-2-(3-hydroxyprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 82950139 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[1-(dimethylamino)propan-2-yl]-5-fluoro-2-(3-hydroxyprop-1-ynyl)benzamide |
| SMILES | CC(CN(C)C)NC(=O)c1cc(F)ccc1C#CCO |
| InChI | InChI=1S/C15H19FN2O2/c1-11(10-18(2)3)17-15(20)14-9-13(16)7-6-12(14)5-4-8-19/h6-7,9,11,19H,8,10H2,1-3H3,(H,17,20) |
| InChIKey | NSWDWHQAAWIVSF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|