C11H22N4O2 — CID 82950387
N-[1-(dimethylamino)propan-2-yl]-1-(N'-hydroxycarbamimidoyl)cyclobutane-1-carboxamide (PubChem CID 82950387) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is N-[1-(dimethylamino)propan-2-yl]-1-(N'-hydroxycarbamimidoyl)cyclobutane-1-carboxamide.
| Compound Name | N-[1-(dimethylamino)propan-2-yl]-1-(N'-hydroxycarbamimidoyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 82950387 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | N-[1-(dimethylamino)propan-2-yl]-1-(N'-hydroxycarbamimidoyl)cyclobutane-1-carboxamide |
| SMILES | CC(CN(C)C)NC(=O)C1(C(N)=NO)CCC1 |
| InChI | InChI=1S/C11H22N4O2/c1-8(7-15(2)3)13-10(16)11(5-4-6-11)9(12)14-17/h8,17H,4-7H2,1-3H3,(H2,12,14)(H,13,16) |
| InChIKey | NVVQSWZQKGMQSS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|