About (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine
(E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine (PubChem CID 82951387) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine |
| PubChem CID | 82951387 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine |
| SMILES | COCCN(C/C=C/CN)C(C)C |
| InChI | InChI=1S/C10H22N2O/c1-10(2)12(8-9-13-3)7-5-4-6-11/h4-5,10H,6-9,11H2,1-3H3/b5-4+ |
| InChIKey | XKSHJFCFHOIWMC-SNAWJCMRSA-N |
| XLogP | 0.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine?
The IUPAC name of (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine (CID 82951387) is (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine.
What is the SMILES notation for (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine?
The canonical SMILES for (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine is COCCN(C/C=C/CN)C(C)C.
What is the InChIKey of (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine?
The InChIKey is XKSHJFCFHOIWMC-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H22N2O/c1-10(2)12(8-9-13-3)7-5-4-6-11/h4-5,10H,6-9,11H2,1-3H3/b5-4+.
What are the key properties of (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine?
(E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine has a molecular weight of 186.30 g/mol, XLogP of 0.86, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(2-methoxyethyl)-N'-propan-2-ylbut-2-ene-1,4-diamine is sourced from PubChem (CID 82951387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).