C15H27N3O2 — CID 82951786
4-[(1S)-1-aminoethyl]-N,N-bis(2-ethoxyethyl)pyridin-2-amine (PubChem CID 82951786) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]-N,N-bis(2-ethoxyethyl)pyridin-2-amine.
| Compound Name | 4-[(1S)-1-aminoethyl]-N,N-bis(2-ethoxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 82951786 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]-N,N-bis(2-ethoxyethyl)pyridin-2-amine |
| SMILES | CCOCCN(CCOCC)c1cc([C@H](C)N)ccn1 |
| InChI | InChI=1S/C15H27N3O2/c1-4-19-10-8-18(9-11-20-5-2)15-12-14(13(3)16)6-7-17-15/h6-7,12-13H,4-5,8-11,16H2,1-3H3/t13-/m0/s1 |
| InChIKey | PQLBGFMFJMWBPA-ZDUSSCGKSA-N |
| XLogP | 1.98 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|