About 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol
4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol (PubChem CID 829533) has the molecular formula C15H10N2O3S
and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol |
| PubChem CID | 829533 |
| Molecular Formula | C15H10N2O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(-c3ccc(O)cc3)n2)c1 |
| InChI | InChI=1S/C15H10N2O3S/c18-13-6-4-10(5-7-13)15-16-14(9-21-15)11-2-1-3-12(8-11)17(19)20/h1-9,18H |
| InChIKey | QBCVWEQEGDRLAH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol?
The IUPAC name of 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol (CID 829533) is 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol.
What is the SMILES notation for 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol?
The canonical SMILES for 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol is O=[N+]([O-])c1cccc(-c2csc(-c3ccc(O)cc3)n2)c1.
What is the InChIKey of 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol?
The InChIKey is QBCVWEQEGDRLAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O3S/c18-13-6-4-10(5-7-13)15-16-14(9-21-15)11-2-1-3-12(8-11)17(19)20/h1-9,18H.
What are the key properties of 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol?
4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol has a molecular weight of 298.32 g/mol, XLogP of 4.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]phenol is sourced from PubChem (CID 829533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).