C12H15F3N2O2 — CID 82954605
N-(3-aminophenyl)-2-(3,3,3-trifluoropropoxy)propanamide (PubChem CID 82954605) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is N-(3-aminophenyl)-2-(3,3,3-trifluoropropoxy)propanamide.
| Compound Name | N-(3-aminophenyl)-2-(3,3,3-trifluoropropoxy)propanamide |
|---|---|
| PubChem CID | 82954605 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(3-aminophenyl)-2-(3,3,3-trifluoropropoxy)propanamide |
| SMILES | CC(OCCC(F)(F)F)C(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C12H15F3N2O2/c1-8(19-6-5-12(13,14)15)11(18)17-10-4-2-3-9(16)7-10/h2-4,7-8H,5-6,16H2,1H3,(H,17,18) |
| InChIKey | CKHLQGNMUNQKON-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|