C11H15F3N2O3S — CID 82954770
4-amino-N-ethyl-3-(3,3,3-trifluoropropoxy)benzenesulfonamide (PubChem CID 82954770) has the molecular formula C11H15F3N2O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-(3,3,3-trifluoropropoxy)benzenesulfonamide.
| Compound Name | 4-amino-N-ethyl-3-(3,3,3-trifluoropropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82954770 |
| Molecular Formula | C11H15F3N2O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-amino-N-ethyl-3-(3,3,3-trifluoropropoxy)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(N)c(OCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3N2O3S/c1-2-16-20(17,18)8-3-4-9(15)10(7-8)19-6-5-11(12,13)14/h3-4,7,16H,2,5-6,15H2,1H3 |
| InChIKey | VIACIDKOSSYJGI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|