C11H18F3NO3 — CID 82955210
7-(3,3,3-trifluoropropoxy)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 82955210) has the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 7-(3,3,3-trifluoropropoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | 7-(3,3,3-trifluoropropoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 82955210 |
| Molecular Formula | C11H18F3NO3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 7-(3,3,3-trifluoropropoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | NC1CCC2(CC1OCCC(F)(F)F)OCCO2 |
| InChI | InChI=1S/C11H18F3NO3/c12-11(13,14)3-4-16-9-7-10(2-1-8(9)15)17-5-6-18-10/h8-9H,1-7,15H2 |
| InChIKey | MZCDYNLJCWGJRV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |