C9H11F3N2O2 — CID 82955498
1,3-dimethyl-5-(3,3,3-trifluoropropoxy)pyrazole-4-carbaldehyde (PubChem CID 82955498) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3,3,3-trifluoropropoxy)pyrazole-4-carbaldehyde.
| Compound Name | 1,3-dimethyl-5-(3,3,3-trifluoropropoxy)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82955498 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1,3-dimethyl-5-(3,3,3-trifluoropropoxy)pyrazole-4-carbaldehyde |
| SMILES | Cc1nn(C)c(OCCC(F)(F)F)c1C=O |
| InChI | InChI=1S/C9H11F3N2O2/c1-6-7(5-15)8(14(2)13-6)16-4-3-9(10,11)12/h5H,3-4H2,1-2H3 |
| InChIKey | DXIIVQIOEVDIAL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|