About 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine
1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine (PubChem CID 82955988) has the molecular formula C9H14F3N3O
and a molecular weight of 237.22 g/mol. Its IUPAC name is 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine |
| PubChem CID | 82955988 |
| Molecular Formula | C9H14F3N3O |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine |
| SMILES | Nc1ccn(CCCOCCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H14F3N3O/c10-9(11,12)3-7-16-6-1-4-15-5-2-8(13)14-15/h2,5H,1,3-4,6-7H2,(H2,13,14) |
| InChIKey | GHDAJKMUHQBILO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine?
The IUPAC name of 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine (CID 82955988) is 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine.
What is the SMILES notation for 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine?
The canonical SMILES for 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine is Nc1ccn(CCCOCCC(F)(F)F)n1.
What is the InChIKey of 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine?
The InChIKey is GHDAJKMUHQBILO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3N3O/c10-9(11,12)3-7-16-6-1-4-15-5-2-8(13)14-15/h2,5H,1,3-4,6-7H2,(H2,13,14).
What are the key properties of 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine?
1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine has a molecular weight of 237.22 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,3,3-trifluoropropoxy)propyl]pyrazol-3-amine is sourced from PubChem (CID 82955988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).