C12H10F3NO2 — CID 82956291
4-[2-(3,3,3-trifluoropropoxy)acetyl]benzonitrile (PubChem CID 82956291) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 4-[2-(3,3,3-trifluoropropoxy)acetyl]benzonitrile.
| Compound Name | 4-[2-(3,3,3-trifluoropropoxy)acetyl]benzonitrile |
|---|---|
| PubChem CID | 82956291 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-[2-(3,3,3-trifluoropropoxy)acetyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)COCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3NO2/c13-12(14,15)5-6-18-8-11(17)10-3-1-9(7-16)2-4-10/h1-4H,5-6,8H2 |
| InChIKey | MHVUBECUAGQWGZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|