About [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine
[5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine (PubChem CID 82956596) has the molecular formula C11H13F4NO
and a molecular weight of 251.22 g/mol. Its IUPAC name is [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine |
| PubChem CID | 82956596 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine |
| SMILES | NCc1cc(F)ccc1COCCC(F)(F)F |
| InChI | InChI=1S/C11H13F4NO/c12-10-2-1-8(9(5-10)6-16)7-17-4-3-11(13,14)15/h1-2,5H,3-4,6-7,16H2 |
| InChIKey | PDVIODFOHUDNJG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine?
The IUPAC name of [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine (CID 82956596) is [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine.
What is the SMILES notation for [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine?
The canonical SMILES for [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine is NCc1cc(F)ccc1COCCC(F)(F)F.
What is the InChIKey of [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine?
The InChIKey is PDVIODFOHUDNJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F4NO/c12-10-2-1-8(9(5-10)6-16)7-17-4-3-11(13,14)15/h1-2,5H,3-4,6-7,16H2.
What are the key properties of [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine?
[5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine has a molecular weight of 251.22 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-2-(3,3,3-trifluoropropoxymethyl)phenyl]methanamine is sourced from PubChem (CID 82956596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).