C18H29BrN2 — CID 82956637
1-[4-bromo-2-(4-propan-2-ylazepan-1-yl)phenyl]-N-methylethanamine (PubChem CID 82956637) has the molecular formula C18H29BrN2 and a molecular weight of 353.35 g/mol. Its IUPAC name is 1-[4-bromo-2-(4-propan-2-ylazepan-1-yl)phenyl]-N-methylethanamine.
| Compound Name | 1-[4-bromo-2-(4-propan-2-ylazepan-1-yl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 82956637 |
| Molecular Formula | C18H29BrN2 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[4-bromo-2-(4-propan-2-ylazepan-1-yl)phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(Br)cc1N1CCCC(C(C)C)CC1 |
| InChI | InChI=1S/C18H29BrN2/c1-13(2)15-6-5-10-21(11-9-15)18-12-16(19)7-8-17(18)14(3)20-4/h7-8,12-15,20H,5-6,9-11H2,1-4H3 |
| InChIKey | QQUCOEXXMXGVBK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |