C15H21BrN2O3 — CID 82956689
1-[(3-bromo-4-hydroxy-5-methoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide (PubChem CID 82956689) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is 1-[(3-bromo-4-hydroxy-5-methoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-[(3-bromo-4-hydroxy-5-methoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 82956689 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1-[(3-bromo-4-hydroxy-5-methoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(Cc2cc(Br)c(O)c(OC)c2)CC1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-17-15(20)11-3-5-18(6-4-11)9-10-7-12(16)14(19)13(8-10)21-2/h7-8,11,19H,3-6,9H2,1-2H3,(H,17,20) |
| InChIKey | NXCMPWUPUSQQAG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |