C11H15F3N4O — CID 82956721
[2-cyclopropyl-5-methyl-6-(3,3,3-trifluoropropoxy)pyrimidin-4-yl]hydrazine (PubChem CID 82956721) has the molecular formula C11H15F3N4O and a molecular weight of 276.26 g/mol. Its IUPAC name is [2-cyclopropyl-5-methyl-6-(3,3,3-trifluoropropoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-cyclopropyl-5-methyl-6-(3,3,3-trifluoropropoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82956721 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [2-cyclopropyl-5-methyl-6-(3,3,3-trifluoropropoxy)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1c(NN)nc(C2CC2)nc1OCCC(F)(F)F |
| InChI | InChI=1S/C11H15F3N4O/c1-6-8(18-15)16-9(7-2-3-7)17-10(6)19-5-4-11(12,13)14/h7H,2-5,15H2,1H3,(H,16,17,18) |
| InChIKey | KVKLZQWSPWQBCU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|