C9H14BrF3O — CID 82956874
2-bromo-1,1-dimethyl-4-(3,3,3-trifluoropropoxy)cyclobutane (PubChem CID 82956874) has the molecular formula C9H14BrF3O and a molecular weight of 275.11 g/mol. Its IUPAC name is 2-bromo-1,1-dimethyl-4-(3,3,3-trifluoropropoxy)cyclobutane.
| Compound Name | 2-bromo-1,1-dimethyl-4-(3,3,3-trifluoropropoxy)cyclobutane |
|---|---|
| PubChem CID | 82956874 |
| Molecular Formula | C9H14BrF3O |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-bromo-1,1-dimethyl-4-(3,3,3-trifluoropropoxy)cyclobutane |
| SMILES | CC1(C)C(Br)CC1OCCC(F)(F)F |
| InChI | InChI=1S/C9H14BrF3O/c1-8(2)6(10)5-7(8)14-4-3-9(11,12)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | JIJBIKUHQYVJDO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|