C16H17NO4 — CID 82957694
6-[(3-methoxy-N-methylanilino)methyl]-1,3-benzodioxol-5-ol (PubChem CID 82957694) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 6-[(3-methoxy-N-methylanilino)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(3-methoxy-N-methylanilino)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 82957694 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 6-[(3-methoxy-N-methylanilino)methyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1cccc(N(C)Cc2cc3c(cc2O)OCO3)c1 |
| InChI | InChI=1S/C16H17NO4/c1-17(12-4-3-5-13(7-12)19-2)9-11-6-15-16(8-14(11)18)21-10-20-15/h3-8,18H,9-10H2,1-2H3 |
| InChIKey | UVIQYOUSNGSPBH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|