C14H17F3N2O — CID 82958723
2-(ethylamino)-2-phenyl-3-(3,3,3-trifluoropropoxy)propanenitrile (PubChem CID 82958723) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-(ethylamino)-2-phenyl-3-(3,3,3-trifluoropropoxy)propanenitrile.
| Compound Name | 2-(ethylamino)-2-phenyl-3-(3,3,3-trifluoropropoxy)propanenitrile |
|---|---|
| PubChem CID | 82958723 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-(ethylamino)-2-phenyl-3-(3,3,3-trifluoropropoxy)propanenitrile |
| SMILES | CCNC(C#N)(COCCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H17F3N2O/c1-2-19-13(10-18,12-6-4-3-5-7-12)11-20-9-8-14(15,16)17/h3-7,19H,2,8-9,11H2,1H3 |
| InChIKey | FZHGJBLVCVNKBS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|