About 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine
6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine (PubChem CID 82961078) has the molecular formula C13H22ClN3O2
and a molecular weight of 287.79 g/mol. Its IUPAC name is 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine |
| PubChem CID | 82961078 |
| Molecular Formula | C13H22ClN3O2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine |
| SMILES | CCOCCN(CCOCC)c1ccc(CCl)nn1 |
| InChI | InChI=1S/C13H22ClN3O2/c1-3-18-9-7-17(8-10-19-4-2)13-6-5-12(11-14)15-16-13/h5-6H,3-4,7-11H2,1-2H3 |
| InChIKey | HKDZVMPZVZTGDC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine?
The IUPAC name of 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine (CID 82961078) is 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine.
What is the SMILES notation for 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine?
The canonical SMILES for 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine is CCOCCN(CCOCC)c1ccc(CCl)nn1.
What is the InChIKey of 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine?
The InChIKey is HKDZVMPZVZTGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22ClN3O2/c1-3-18-9-7-17(8-10-19-4-2)13-6-5-12(11-14)15-16-13/h5-6H,3-4,7-11H2,1-2H3.
What are the key properties of 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine?
6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine has a molecular weight of 287.79 g/mol, XLogP of 2.09, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine is sourced from PubChem (CID 82961078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).