C13H22ClN3O2 — CID 82961078
6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine (PubChem CID 82961078) has the molecular formula C13H22ClN3O2 and a molecular weight of 287.79 g/mol. Its IUPAC name is 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine.
| Compound Name | 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 82961078 |
| Molecular Formula | C13H22ClN3O2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-(chloromethyl)-N,N-bis(2-ethoxyethyl)pyridazin-3-amine |
| SMILES | CCOCCN(CCOCC)c1ccc(CCl)nn1 |
| InChI | InChI=1S/C13H22ClN3O2/c1-3-18-9-7-17(8-10-19-4-2)13-6-5-12(11-14)15-16-13/h5-6H,3-4,7-11H2,1-2H3 |
| InChIKey | HKDZVMPZVZTGDC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|