About 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine
6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine (PubChem CID 82961160) has the molecular formula C12H21ClN4O2
and a molecular weight of 288.78 g/mol. Its IUPAC name is 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine |
| PubChem CID | 82961160 |
| Molecular Formula | C12H21ClN4O2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine |
| SMILES | CCOCCN(CCOCC)c1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C12H21ClN4O2/c1-3-18-7-5-17(6-8-19-4-2)11-9-10(13)15-12(14)16-11/h9H,3-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | HNSNTVRZVALRRL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine?
The IUPAC name of 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine (CID 82961160) is 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine is CCOCCN(CCOCC)c1cc(Cl)nc(N)n1.
What is the InChIKey of 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine?
The InChIKey is HNSNTVRZVALRRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClN4O2/c1-3-18-7-5-17(6-8-19-4-2)11-9-10(13)15-12(14)16-11/h9H,3-8H2,1-2H3,(H2,14,15,16).
What are the key properties of 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine?
6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine has a molecular weight of 288.78 g/mol, XLogP of 1.59, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-N,4-N-bis(2-ethoxyethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 82961160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).