C13H25N3O3 — CID 82961613
(2S)-2-amino-3-methyl-N-[2-[methyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]butanamide (PubChem CID 82961613) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[2-[methyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[2-[methyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 82961613 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[2-[methyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]butanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)N(C)CC1CCCO1 |
| InChI | InChI=1S/C13H25N3O3/c1-9(2)12(14)13(18)15-7-11(17)16(3)8-10-5-4-6-19-10/h9-10,12H,4-8,14H2,1-3H3,(H,15,18)/t10?,12-/m0/s1 |
| InChIKey | HOYDASYTYMGMKM-KFJBMODSSA-N |
| XLogP | -0.28 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |