C13H17N5O2Se — CID 82963468
(2S)-2-amino-N-[2-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-2-oxoethyl]-3-methylbutanamide (PubChem CID 82963468) has the molecular formula C13H17N5O2Se and a molecular weight of 354.27 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 82963468 |
| Molecular Formula | C13H17N5O2Se |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | (2S)-2-amino-N-[2-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-2-oxoethyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)Nc1cccc2c1N=[Se]=N2 |
| InChI | InChI=1S/C13H17N5O2Se/c1-7(2)11(14)13(20)15-6-10(19)16-8-4-3-5-9-12(8)18-21-17-9/h3-5,7,11H,6,14H2,1-2H3,(H,15,20)(H,16,19)/t11-/m0/s1 |
| InChIKey | KQWUXXSOPRHELS-NSHDSACASA-N |
| XLogP | 1.07 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|