C16H15BrFNO2 — CID 82963526
4-[1-(4-bromo-2-fluorophenyl)ethylamino]-3-methylbenzoic acid (PubChem CID 82963526) has the molecular formula C16H15BrFNO2 and a molecular weight of 352.20 g/mol. Its IUPAC name is 4-[1-(4-bromo-2-fluorophenyl)ethylamino]-3-methylbenzoic acid.
| Compound Name | 4-[1-(4-bromo-2-fluorophenyl)ethylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 82963526 |
| Molecular Formula | C16H15BrFNO2 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 4-[1-(4-bromo-2-fluorophenyl)ethylamino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NC(C)c1ccc(Br)cc1F |
| InChI | InChI=1S/C16H15BrFNO2/c1-9-7-11(16(20)21)3-6-15(9)19-10(2)13-5-4-12(17)8-14(13)18/h3-8,10,19H,1-2H3,(H,20,21) |
| InChIKey | RTPYPPTTZOAGGA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |