C14H25N3O4 — CID 82964102
1-[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]-3-methylpiperidine-3-carboxylic acid (PubChem CID 82964102) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]-3-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]-3-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 82964102 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1-[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]-3-methylpiperidine-3-carboxylic acid |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)N1CCCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C14H25N3O4/c1-9(2)11(15)12(19)16-7-10(18)17-6-4-5-14(3,8-17)13(20)21/h9,11H,4-8,15H2,1-3H3,(H,16,19)(H,20,21)/t11-,14?/m0/s1 |
| InChIKey | GCYMGTCMZFPFPU-ZSOXZCCMSA-N |
| XLogP | -0.20 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |