C13H19N3O4S — CID 82964540
2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-2-thiophen-2-ylacetic acid (PubChem CID 82964540) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 82964540 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-2-thiophen-2-ylacetic acid |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C13H19N3O4S/c1-7(2)10(14)12(18)15-6-9(17)16-11(13(19)20)8-4-3-5-21-8/h3-5,7,10-11H,6,14H2,1-2H3,(H,15,18)(H,16,17)(H,19,20)/t10-,11?/m0/s1 |
| InChIKey | WDJOGZMDWMTWRK-VUWPPUDQSA-N |
| XLogP | 0.09 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |