C16H17BrFNO2 — CID 82964704
N-[1-(4-bromo-2-fluorophenyl)ethyl]-3,5-dimethoxyaniline (PubChem CID 82964704) has the molecular formula C16H17BrFNO2 and a molecular weight of 354.22 g/mol. Its IUPAC name is N-[1-(4-bromo-2-fluorophenyl)ethyl]-3,5-dimethoxyaniline.
| Compound Name | N-[1-(4-bromo-2-fluorophenyl)ethyl]-3,5-dimethoxyaniline |
|---|---|
| PubChem CID | 82964704 |
| Molecular Formula | C16H17BrFNO2 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[1-(4-bromo-2-fluorophenyl)ethyl]-3,5-dimethoxyaniline |
| SMILES | COc1cc(NC(C)c2ccc(Br)cc2F)cc(OC)c1 |
| InChI | InChI=1S/C16H17BrFNO2/c1-10(15-5-4-11(17)6-16(15)18)19-12-7-13(20-2)9-14(8-12)21-3/h4-10,19H,1-3H3 |
| InChIKey | RMNGLTYSCQLQKC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |