C15H27N3O2 — CID 82965174
N,N-bis(2-ethoxyethyl)-1-pyridin-2-ylethane-1,2-diamine (PubChem CID 82965174) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-1-pyridin-2-ylethane-1,2-diamine.
| Compound Name | N,N-bis(2-ethoxyethyl)-1-pyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 82965174 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-1-pyridin-2-ylethane-1,2-diamine |
| SMILES | CCOCCN(CCOCC)C(CN)c1ccccn1 |
| InChI | InChI=1S/C15H27N3O2/c1-3-19-11-9-18(10-12-20-4-2)15(13-16)14-7-5-6-8-17-14/h5-8,15H,3-4,9-13,16H2,1-2H3 |
| InChIKey | QFDYPWFSIPMWMO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|