C13H22BrN3O2 — CID 82965351
3-bromo-2-N,2-N-bis(2-ethoxyethyl)pyridine-2,5-diamine (PubChem CID 82965351) has the molecular formula C13H22BrN3O2 and a molecular weight of 332.24 g/mol. Its IUPAC name is 3-bromo-2-N,2-N-bis(2-ethoxyethyl)pyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N,2-N-bis(2-ethoxyethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 82965351 |
| Molecular Formula | C13H22BrN3O2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 3-bromo-2-N,2-N-bis(2-ethoxyethyl)pyridine-2,5-diamine |
| SMILES | CCOCCN(CCOCC)c1ncc(N)cc1Br |
| InChI | InChI=1S/C13H22BrN3O2/c1-3-18-7-5-17(6-8-19-4-2)13-12(14)9-11(15)10-16-13/h9-10H,3-8,15H2,1-2H3 |
| InChIKey | YSIKXLQQMXAJBE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|