C13H30N2O2S — CID 82965661
2-N,2-N-bis(2-ethoxyethyl)-4-methylsulfanylbutane-1,2-diamine (PubChem CID 82965661) has the molecular formula C13H30N2O2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 2-N,2-N-bis(2-ethoxyethyl)-4-methylsulfanylbutane-1,2-diamine.
| Compound Name | 2-N,2-N-bis(2-ethoxyethyl)-4-methylsulfanylbutane-1,2-diamine |
|---|---|
| PubChem CID | 82965661 |
| Molecular Formula | C13H30N2O2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-N,2-N-bis(2-ethoxyethyl)-4-methylsulfanylbutane-1,2-diamine |
| SMILES | CCOCCN(CCOCC)C(CN)CCSC |
| InChI | InChI=1S/C13H30N2O2S/c1-4-16-9-7-15(8-10-17-5-2)13(12-14)6-11-18-3/h13H,4-12,14H2,1-3H3 |
| InChIKey | NXZXFRFDEBDNDK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|