C11H21N5O3 — CID 82966075
3-amino-N,N-bis(2-ethoxyethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 82966075) has the molecular formula C11H21N5O3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-ethoxyethyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N,N-bis(2-ethoxyethyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 82966075 |
| Molecular Formula | C11H21N5O3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-amino-N,N-bis(2-ethoxyethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCOCCN(CCOCC)C(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C11H21N5O3/c1-3-18-7-5-16(6-8-19-4-2)10(17)9-13-11(12)15-14-9/h3-8H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | RNFCWINHHRPYLR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|