C13H26N2O4 — CID 82966183
3-amino-N,N-bis(2-ethoxyethyl)oxolane-3-carboxamide (PubChem CID 82966183) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-ethoxyethyl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N,N-bis(2-ethoxyethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 82966183 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 3-amino-N,N-bis(2-ethoxyethyl)oxolane-3-carboxamide |
| SMILES | CCOCCN(CCOCC)C(=O)C1(N)CCOC1 |
| InChI | InChI=1S/C13H26N2O4/c1-3-17-9-6-15(7-10-18-4-2)12(16)13(14)5-8-19-11-13/h3-11,14H2,1-2H3 |
| InChIKey | QVXFUWXCFYPKGC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|