C16H15BrO2 — CID 82967401
1-[4-bromo-2-(3,5-dimethylphenoxy)phenyl]ethanone (PubChem CID 82967401) has the molecular formula C16H15BrO2 and a molecular weight of 319.20 g/mol. Its IUPAC name is 1-[4-bromo-2-(3,5-dimethylphenoxy)phenyl]ethanone.
| Compound Name | 1-[4-bromo-2-(3,5-dimethylphenoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 82967401 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-[4-bromo-2-(3,5-dimethylphenoxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Br)cc1Oc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H15BrO2/c1-10-6-11(2)8-14(7-10)19-16-9-13(17)4-5-15(16)12(3)18/h4-9H,1-3H3 |
| InChIKey | JTURUNNWMDYPIT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |