C14H18BrN3O2 — CID 82968256
4-[2-(1-aminoethyl)-4-bromophenyl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 82968256) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is 4-[2-(1-aminoethyl)-4-bromophenyl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[2-(1-aminoethyl)-4-bromophenyl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 82968256 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 4-[2-(1-aminoethyl)-4-bromophenyl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC(N)c1cc(Br)ccc1N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C14H18BrN3O2/c1-8(16)10-6-9(15)4-5-11(10)18-7-12(19)17-13(20)14(18,2)3/h4-6,8H,7,16H2,1-3H3,(H,17,19,20) |
| InChIKey | XTQCCUOZSQGOCK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|