C16H20N2O2 — CID 82969757
methyl 2-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]benzoate (PubChem CID 82969757) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is methyl 2-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]benzoate.
| Compound Name | methyl 2-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 82969757 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | methyl 2-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]benzoate |
| SMILES | CCc1c(C)nn(Cc2ccccc2C(=O)OC)c1C |
| InChI | InChI=1S/C16H20N2O2/c1-5-14-11(2)17-18(12(14)3)10-13-8-6-7-9-15(13)16(19)20-4/h6-9H,5,10H2,1-4H3 |
| InChIKey | XZDPOUCFYGITNB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |