C16H27BrN2 — CID 82972419
4-bromo-N-ethyl-2-[1-(ethylamino)ethyl]-N-(2-methylpropyl)aniline (PubChem CID 82972419) has the molecular formula C16H27BrN2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 4-bromo-N-ethyl-2-[1-(ethylamino)ethyl]-N-(2-methylpropyl)aniline.
| Compound Name | 4-bromo-N-ethyl-2-[1-(ethylamino)ethyl]-N-(2-methylpropyl)aniline |
|---|---|
| PubChem CID | 82972419 |
| Molecular Formula | C16H27BrN2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-bromo-N-ethyl-2-[1-(ethylamino)ethyl]-N-(2-methylpropyl)aniline |
| SMILES | CCNC(C)c1cc(Br)ccc1N(CC)CC(C)C |
| InChI | InChI=1S/C16H27BrN2/c1-6-18-13(5)15-10-14(17)8-9-16(15)19(7-2)11-12(3)4/h8-10,12-13,18H,6-7,11H2,1-5H3 |
| InChIKey | UACGZRCXXKJHQG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |