About 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide
3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide (PubChem CID 82973031) has the molecular formula C12H15BrFNO2S
and a molecular weight of 336.23 g/mol. Its IUPAC name is 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide |
| PubChem CID | 82973031 |
| Molecular Formula | C12H15BrFNO2S |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide |
| SMILES | CC1CCNC(c2cc(Br)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C12H15BrFNO2S/c1-8-4-5-15-12(7-18(8,16)17)10-6-9(13)2-3-11(10)14/h2-3,6,8,12,15H,4-5,7H2,1H3 |
| InChIKey | PRQNYZQMXHXRQQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide?
The IUPAC name of 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide (CID 82973031) is 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide.
What is the SMILES notation for 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide?
The canonical SMILES for 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide is CC1CCNC(c2cc(Br)ccc2F)CS1(=O)=O.
What is the InChIKey of 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide?
The InChIKey is PRQNYZQMXHXRQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrFNO2S/c1-8-4-5-15-12(7-18(8,16)17)10-6-9(13)2-3-11(10)14/h2-3,6,8,12,15H,4-5,7H2,1H3.
What are the key properties of 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide?
3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide has a molecular weight of 336.23 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-2-fluorophenyl)-7-methyl-1,4-thiazepane 1,1-dioxide is sourced from PubChem (CID 82973031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).