C14H11BrF2OS — CID 82973110
1-[5-bromo-2-(2,5-difluorophenyl)sulfanylphenyl]ethanol (PubChem CID 82973110) has the molecular formula C14H11BrF2OS and a molecular weight of 345.21 g/mol. Its IUPAC name is 1-[5-bromo-2-(2,5-difluorophenyl)sulfanylphenyl]ethanol.
| Compound Name | 1-[5-bromo-2-(2,5-difluorophenyl)sulfanylphenyl]ethanol |
|---|---|
| PubChem CID | 82973110 |
| Molecular Formula | C14H11BrF2OS |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 1-[5-bromo-2-(2,5-difluorophenyl)sulfanylphenyl]ethanol |
| SMILES | CC(O)c1cc(Br)ccc1Sc1cc(F)ccc1F |
| InChI | InChI=1S/C14H11BrF2OS/c1-8(18)11-6-9(15)2-5-13(11)19-14-7-10(16)3-4-12(14)17/h2-8,18H,1H3 |
| InChIKey | CWRDMTHPICVIEE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |