C11H15NO2S — CID 82973176
4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenol (PubChem CID 82973176) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenol.
| Compound Name | 4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 82973176 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenol |
| SMILES | O=S1CCN(Cc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C11H15NO2S/c13-11-3-1-10(2-4-11)9-12-5-7-15(14)8-6-12/h1-4,13H,5-9H2 |
| InChIKey | KVOFHCLOXHVQJH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |