C14H20ClNO — CID 82974860
3-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]phenol (PubChem CID 82974860) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 3-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]phenol.
| Compound Name | 3-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 82974860 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]phenol |
| SMILES | CC1CC(C)CN(Cc2c(O)cccc2Cl)C1 |
| InChI | InChI=1S/C14H20ClNO/c1-10-6-11(2)8-16(7-10)9-12-13(15)4-3-5-14(12)17/h3-5,10-11,17H,6-9H2,1-2H3 |
| InChIKey | CHEPATDYEKKAMP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|