About 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol
6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol (PubChem CID 82978402) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol |
| PubChem CID | 82978402 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol |
| SMILES | Cc1cc(C)cc(N(C)Cc2ccc(O)cn2)c1 |
| InChI | InChI=1S/C15H18N2O/c1-11-6-12(2)8-14(7-11)17(3)10-13-4-5-15(18)9-16-13/h4-9,18H,10H2,1-3H3 |
| InChIKey | YOGMKJUECZSGDA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol?
The IUPAC name of 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol (CID 82978402) is 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol.
What is the SMILES notation for 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol?
The canonical SMILES for 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol is Cc1cc(C)cc(N(C)Cc2ccc(O)cn2)c1.
What is the InChIKey of 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol?
The InChIKey is YOGMKJUECZSGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c1-11-6-12(2)8-14(7-11)17(3)10-13-4-5-15(18)9-16-13/h4-9,18H,10H2,1-3H3.
What are the key properties of 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol?
6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol has a molecular weight of 242.32 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(N,3,5-trimethylanilino)methyl]pyridin-3-ol is sourced from PubChem (CID 82978402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).