About 4-(1,3-benzothiazol-2-yl)butanoic acid
4-(1,3-benzothiazol-2-yl)butanoic acid (PubChem CID 829788) has the molecular formula C11H11NO2S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-yl)butanoic acid |
| PubChem CID | 829788 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)butanoic acid |
| SMILES | O=C(O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11NO2S/c13-11(14)7-3-6-10-12-8-4-1-2-5-9(8)15-10/h1-2,4-5H,3,6-7H2,(H,13,14) |
| InChIKey | DOTLYHUQAIHKEV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-benzothiazol-2-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-yl)butanoic acid?
The IUPAC name of 4-(1,3-benzothiazol-2-yl)butanoic acid (CID 829788) is 4-(1,3-benzothiazol-2-yl)butanoic acid.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yl)butanoic acid?
The canonical SMILES for 4-(1,3-benzothiazol-2-yl)butanoic acid is O=C(O)CCCc1nc2ccccc2s1.
What is the InChIKey of 4-(1,3-benzothiazol-2-yl)butanoic acid?
The InChIKey is DOTLYHUQAIHKEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S/c13-11(14)7-3-6-10-12-8-4-1-2-5-9(8)15-10/h1-2,4-5H,3,6-7H2,(H,13,14).
What are the key properties of 4-(1,3-benzothiazol-2-yl)butanoic acid?
4-(1,3-benzothiazol-2-yl)butanoic acid has a molecular weight of 221.28 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yl)butanoic acid is sourced from PubChem (CID 829788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).