C14H20ClNO2 — CID 82980475
4-chloro-2-[[methyl(oxan-4-ylmethyl)amino]methyl]phenol (PubChem CID 82980475) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 4-chloro-2-[[methyl(oxan-4-ylmethyl)amino]methyl]phenol.
| Compound Name | 4-chloro-2-[[methyl(oxan-4-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 82980475 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-chloro-2-[[methyl(oxan-4-ylmethyl)amino]methyl]phenol |
| SMILES | CN(Cc1cc(Cl)ccc1O)CC1CCOCC1 |
| InChI | InChI=1S/C14H20ClNO2/c1-16(9-11-4-6-18-7-5-11)10-12-8-13(15)2-3-14(12)17/h2-3,8,11,17H,4-7,9-10H2,1H3 |
| InChIKey | GDCQYYIVWSXNAE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|