About 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol
2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol (PubChem CID 82980842) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol.
Molecular Properties
| Compound Name | 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol |
| PubChem CID | 82980842 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol |
| SMILES | CCC(c1ccccc1O)N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C16H26N2O/c1-5-14(13-8-6-7-9-15(13)19)18-11-10-17(4)16(2,3)12-18/h6-9,14,19H,5,10-12H2,1-4H3 |
| InChIKey | SVMJHDKGEVTJAV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol?
The IUPAC name of 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol (CID 82980842) is 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol.
What is the SMILES notation for 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol?
The canonical SMILES for 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol is CCC(c1ccccc1O)N1CCN(C)C(C)(C)C1.
What is the InChIKey of 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol?
The InChIKey is SVMJHDKGEVTJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O/c1-5-14(13-8-6-7-9-15(13)19)18-11-10-17(4)16(2,3)12-18/h6-9,14,19H,5,10-12H2,1-4H3.
What are the key properties of 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol?
2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol has a molecular weight of 262.40 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,3,4-trimethylpiperazin-1-yl)propyl]phenol is sourced from PubChem (CID 82980842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).