C14H21BrN2O — CID 82980898
4-bromo-2-[(4-ethyl-3-methylpiperazin-1-yl)methyl]phenol (PubChem CID 82980898) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is 4-bromo-2-[(4-ethyl-3-methylpiperazin-1-yl)methyl]phenol.
| Compound Name | 4-bromo-2-[(4-ethyl-3-methylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 82980898 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-bromo-2-[(4-ethyl-3-methylpiperazin-1-yl)methyl]phenol |
| SMILES | CCN1CCN(Cc2cc(Br)ccc2O)CC1C |
| InChI | InChI=1S/C14H21BrN2O/c1-3-17-7-6-16(9-11(17)2)10-12-8-13(15)4-5-14(12)18/h4-5,8,11,18H,3,6-7,9-10H2,1-2H3 |
| InChIKey | ACGDBSUSHPLPBQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|