C14H22BrNO — CID 82981508
4-bromo-2-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]phenol (PubChem CID 82981508) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 4-bromo-2-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]phenol.
| Compound Name | 4-bromo-2-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 82981508 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-bromo-2-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]phenol |
| SMILES | CC(N(C)Cc1cc(Br)ccc1O)C(C)(C)C |
| InChI | InChI=1S/C14H22BrNO/c1-10(14(2,3)4)16(5)9-11-8-12(15)6-7-13(11)17/h6-8,10,17H,9H2,1-5H3 |
| InChIKey | OAJZZCYPGBPSCL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|