C18H27NO — CID 82981782
2-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)propyl]phenol (PubChem CID 82981782) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)propyl]phenol.
| Compound Name | 2-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)propyl]phenol |
|---|---|
| PubChem CID | 82981782 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)propyl]phenol |
| SMILES | CCC(c1ccccc1O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C18H27NO/c1-2-16(15-10-4-6-12-18(15)20)19-13-7-9-14-8-3-5-11-17(14)19/h4,6,10,12,14,16-17,20H,2-3,5,7-9,11,13H2,1H3 |
| InChIKey | WDQDBZDKXOBMMY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|