C15H14F3NO — CID 82981844
4-[(N-ethyl-2-fluoroanilino)methyl]-2,6-difluorophenol (PubChem CID 82981844) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is 4-[(N-ethyl-2-fluoroanilino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(N-ethyl-2-fluoroanilino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 82981844 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-[(N-ethyl-2-fluoroanilino)methyl]-2,6-difluorophenol |
| SMILES | CCN(Cc1cc(F)c(O)c(F)c1)c1ccccc1F |
| InChI | InChI=1S/C15H14F3NO/c1-2-19(14-6-4-3-5-11(14)16)9-10-7-12(17)15(20)13(18)8-10/h3-8,20H,2,9H2,1H3 |
| InChIKey | KCRGYQOZJRHBSF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |