C15H21BrN2O2 — CID 82983196
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-2-bromo-6-methoxyphenol (PubChem CID 82983196) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-2-bromo-6-methoxyphenol.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-2-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 82983196 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-2-bromo-6-methoxyphenol |
| SMILES | COc1cc(CN2CCN3CCCC3C2)cc(Br)c1O |
| InChI | InChI=1S/C15H21BrN2O2/c1-20-14-8-11(7-13(16)15(14)19)9-17-5-6-18-4-2-3-12(18)10-17/h7-8,12,19H,2-6,9-10H2,1H3 |
| InChIKey | KMSVHNUCISCXAK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |