C17H28N2O — CID 82983981
N-(4-aminophenyl)-N,2-dipropylpentanamide (PubChem CID 82983981) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-(4-aminophenyl)-N,2-dipropylpentanamide.
| Compound Name | N-(4-aminophenyl)-N,2-dipropylpentanamide |
|---|---|
| PubChem CID | 82983981 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-(4-aminophenyl)-N,2-dipropylpentanamide |
| SMILES | CCCC(CCC)C(=O)N(CCC)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H28N2O/c1-4-7-14(8-5-2)17(20)19(13-6-3)16-11-9-15(18)10-12-16/h9-12,14H,4-8,13,18H2,1-3H3 |
| InChIKey | DTGJPIZLQAIXTD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|