C14H20N4O2 — CID 82989263
3-amino-4-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-N-methylbenzamide (PubChem CID 82989263) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-amino-4-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-N-methylbenzamide.
| Compound Name | 3-amino-4-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 82989263 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-amino-4-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N(C)CC(=O)NC2CC2)c(N)c1 |
| InChI | InChI=1S/C14H20N4O2/c1-16-14(20)9-3-6-12(11(15)7-9)18(2)8-13(19)17-10-4-5-10/h3,6-7,10H,4-5,8,15H2,1-2H3,(H,16,20)(H,17,19) |
| InChIKey | VPHQPJQKCUDYCB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|